C20H31NO5 — CID 100759422
ethyl 2-ethoxy-5-[[(2R)-2-ethoxy-2,4-dimethylpentanoyl]amino]benzoate (PubChem CID 100759422) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is ethyl 2-ethoxy-5-[[(2R)-2-ethoxy-2,4-dimethylpentanoyl]amino]benzoate.
| Compound Name | ethyl 2-ethoxy-5-[[(2R)-2-ethoxy-2,4-dimethylpentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 100759422 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | ethyl 2-ethoxy-5-[[(2R)-2-ethoxy-2,4-dimethylpentanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)[C@@](C)(CC(C)C)OCC)ccc1OCC |
| InChI | InChI=1S/C20H31NO5/c1-7-24-17-11-10-15(12-16(17)18(22)25-8-2)21-19(23)20(6,26-9-3)13-14(4)5/h10-12,14H,7-9,13H2,1-6H3,(H,21,23)/t20-/m1/s1 |
| InChIKey | DXTZDBPBKOBFDQ-HXUWFJFHSA-N |
| XLogP | 4.04 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |