C19H29NO5 — CID 100764118
ethyl 2-ethoxy-5-[[(2R)-2-methyl-2-propoxybutanoyl]amino]benzoate (PubChem CID 100764118) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is ethyl 2-ethoxy-5-[[(2R)-2-methyl-2-propoxybutanoyl]amino]benzoate.
| Compound Name | ethyl 2-ethoxy-5-[[(2R)-2-methyl-2-propoxybutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 100764118 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | ethyl 2-ethoxy-5-[[(2R)-2-methyl-2-propoxybutanoyl]amino]benzoate |
| SMILES | CCCO[C@](C)(CC)C(=O)Nc1ccc(OCC)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C19H29NO5/c1-6-12-25-19(5,7-2)18(22)20-14-10-11-16(23-8-3)15(13-14)17(21)24-9-4/h10-11,13H,6-9,12H2,1-5H3,(H,20,22)/t19-/m1/s1 |
| InChIKey | VGFHPDPVPNWHNE-LJQANCHMSA-N |
| XLogP | 3.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |