C24H39NO5 — CID 100765542
ethyl 2-ethoxy-5-[[4-methyl-2-(2-methylpropyl)-2-propoxypentanoyl]amino]benzoate (PubChem CID 100765542) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is ethyl 2-ethoxy-5-[[4-methyl-2-(2-methylpropyl)-2-propoxypentanoyl]amino]benzoate.
| Compound Name | ethyl 2-ethoxy-5-[[4-methyl-2-(2-methylpropyl)-2-propoxypentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 100765542 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | ethyl 2-ethoxy-5-[[4-methyl-2-(2-methylpropyl)-2-propoxypentanoyl]amino]benzoate |
| SMILES | CCCOC(CC(C)C)(CC(C)C)C(=O)Nc1ccc(OCC)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C24H39NO5/c1-8-13-30-24(15-17(4)5,16-18(6)7)23(27)25-19-11-12-21(28-9-2)20(14-19)22(26)29-10-3/h11-12,14,17-18H,8-10,13,15-16H2,1-7H3,(H,25,27) |
| InChIKey | MJPLRLACLRZSDD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |