C24H38N2O3 — CID 100765606
N-(4-butoxy-3-cyanophenyl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide (PubChem CID 100765606) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is N-(4-butoxy-3-cyanophenyl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide.
| Compound Name | N-(4-butoxy-3-cyanophenyl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide |
|---|---|
| PubChem CID | 100765606 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | N-(4-butoxy-3-cyanophenyl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide |
| SMILES | CCCCOc1ccc(NC(=O)C(CC(C)C)(CC(C)C)OCCC)cc1C#N |
| InChI | InChI=1S/C24H38N2O3/c1-7-9-13-28-22-11-10-21(14-20(22)17-25)26-23(27)24(15-18(3)4,16-19(5)6)29-12-8-2/h10-11,14,18-19H,7-9,12-13,15-16H2,1-6H3,(H,26,27) |
| InChIKey | RPPGUFMXUXBFLG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|