C19H28N2O3 — CID 133229739
N-(4-butoxy-3-cyanophenyl)-2-methoxy-2,4-dimethylpentanamide (PubChem CID 133229739) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-(4-butoxy-3-cyanophenyl)-2-methoxy-2,4-dimethylpentanamide.
| Compound Name | N-(4-butoxy-3-cyanophenyl)-2-methoxy-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 133229739 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-(4-butoxy-3-cyanophenyl)-2-methoxy-2,4-dimethylpentanamide |
| SMILES | CCCCOc1ccc(NC(=O)C(C)(CC(C)C)OC)cc1C#N |
| InChI | InChI=1S/C19H28N2O3/c1-6-7-10-24-17-9-8-16(11-15(17)13-20)21-18(22)19(4,23-5)12-14(2)3/h8-9,11,14H,6-7,10,12H2,1-5H3,(H,21,22) |
| InChIKey | FLFWXRSIXXLWDU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|