C25H37NO3 — CID 100765689
N-(4-ethoxynaphthalen-1-yl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide (PubChem CID 100765689) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is N-(4-ethoxynaphthalen-1-yl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide.
| Compound Name | N-(4-ethoxynaphthalen-1-yl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide |
|---|---|
| PubChem CID | 100765689 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | N-(4-ethoxynaphthalen-1-yl)-4-methyl-2-(2-methylpropyl)-2-propoxypentanamide |
| SMILES | CCCOC(CC(C)C)(CC(C)C)C(=O)Nc1ccc(OCC)c2ccccc12 |
| InChI | InChI=1S/C25H37NO3/c1-7-15-29-25(16-18(3)4,17-19(5)6)24(27)26-22-13-14-23(28-8-2)21-12-10-9-11-20(21)22/h9-14,18-19H,7-8,15-17H2,1-6H3,(H,26,27) |
| InChIKey | PNQMZOVOSQXSNQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |