C24H35NO3 — CID 100766183
(2R)-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]-2-propoxyhexanamide (PubChem CID 100766183) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is (2R)-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]-2-propoxyhexanamide.
| Compound Name | (2R)-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]-2-propoxyhexanamide |
|---|---|
| PubChem CID | 100766183 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (2R)-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]-2-propoxyhexanamide |
| SMILES | CCCC[C@@](C)(OCCC)C(=O)Nc1ccc(OCC(C)C)c2ccccc12 |
| InChI | InChI=1S/C24H35NO3/c1-6-8-15-24(5,28-16-7-2)23(26)25-21-13-14-22(27-17-18(3)4)20-12-10-9-11-19(20)21/h9-14,18H,6-8,15-17H2,1-5H3,(H,25,26)/t24-/m1/s1 |
| InChIKey | HJUBNQUPTFEMOV-XMMPIXPASA-N |
| XLogP | 6.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |