C22H31NO3 — CID 100764450
(2S)-N-[4-[(2S)-butan-2-yl]oxynaphthalen-1-yl]-2-methyl-2-propoxybutanamide (PubChem CID 100764450) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (2S)-N-[4-[(2S)-butan-2-yl]oxynaphthalen-1-yl]-2-methyl-2-propoxybutanamide.
| Compound Name | (2S)-N-[4-[(2S)-butan-2-yl]oxynaphthalen-1-yl]-2-methyl-2-propoxybutanamide |
|---|---|
| PubChem CID | 100764450 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (2S)-N-[4-[(2S)-butan-2-yl]oxynaphthalen-1-yl]-2-methyl-2-propoxybutanamide |
| SMILES | CCCO[C@@](C)(CC)C(=O)Nc1ccc(O[C@@H](C)CC)c2ccccc12 |
| InChI | InChI=1S/C22H31NO3/c1-6-15-25-22(5,8-3)21(24)23-19-13-14-20(26-16(4)7-2)18-12-10-9-11-17(18)19/h9-14,16H,6-8,15H2,1-5H3,(H,23,24)/t16-,22-/m0/s1 |
| InChIKey | DINRTEOZBCACOX-AOMKIAJQSA-N |
| XLogP | 5.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |