C29H29NO2 — CID 100781678
2,2-diphenyl-N-(4-propan-2-yloxynaphthalen-1-yl)butanamide (PubChem CID 100781678) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2,2-diphenyl-N-(4-propan-2-yloxynaphthalen-1-yl)butanamide.
| Compound Name | 2,2-diphenyl-N-(4-propan-2-yloxynaphthalen-1-yl)butanamide |
|---|---|
| PubChem CID | 100781678 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2,2-diphenyl-N-(4-propan-2-yloxynaphthalen-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(OC(C)C)c2ccccc12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO2/c1-4-29(22-13-7-5-8-14-22,23-15-9-6-10-16-23)28(31)30-26-19-20-27(32-21(2)3)25-18-12-11-17-24(25)26/h5-21H,4H2,1-3H3,(H,30,31) |
| InChIKey | YSEJNQKUBAAMNI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |