C25H35NO3 — CID 133205425
N-(4-butan-2-yloxynaphthalen-1-yl)-1-propoxycycloheptane-1-carboxamide (PubChem CID 133205425) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-(4-butan-2-yloxynaphthalen-1-yl)-1-propoxycycloheptane-1-carboxamide.
| Compound Name | N-(4-butan-2-yloxynaphthalen-1-yl)-1-propoxycycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 133205425 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N-(4-butan-2-yloxynaphthalen-1-yl)-1-propoxycycloheptane-1-carboxamide |
| SMILES | CCCOC1(C(=O)Nc2ccc(OC(C)CC)c3ccccc23)CCCCCC1 |
| InChI | InChI=1S/C25H35NO3/c1-4-18-28-25(16-10-6-7-11-17-25)24(27)26-22-14-15-23(29-19(3)5-2)21-13-9-8-12-20(21)22/h8-9,12-15,19H,4-7,10-11,16-18H2,1-3H3,(H,26,27) |
| InChIKey | CWOFENUIICZQSC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |