C22H34N2O3 — CID 100766555
(2R)-N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methyl-2-propoxyheptanamide (PubChem CID 100766555) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is (2R)-N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methyl-2-propoxyheptanamide.
| Compound Name | (2R)-N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methyl-2-propoxyheptanamide |
|---|---|
| PubChem CID | 100766555 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (2R)-N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methyl-2-propoxyheptanamide |
| SMILES | CCCCC[C@@](C)(OCCC)C(=O)Nc1ccc(OCC(C)C)cc1C#N |
| InChI | InChI=1S/C22H34N2O3/c1-6-8-9-12-22(5,27-13-7-2)21(25)24-20-11-10-19(14-18(20)15-23)26-16-17(3)4/h10-11,14,17H,6-9,12-13,16H2,1-5H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | RKVDOIOWWDMYDF-JOCHJYFZSA-N |
| XLogP | 5.30 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|