C17H24N2O3 — CID 100752811
(2R)-N-(4-butoxy-2-cyanophenyl)-2-methoxy-2-methylbutanamide (PubChem CID 100752811) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2R)-N-(4-butoxy-2-cyanophenyl)-2-methoxy-2-methylbutanamide.
| Compound Name | (2R)-N-(4-butoxy-2-cyanophenyl)-2-methoxy-2-methylbutanamide |
|---|---|
| PubChem CID | 100752811 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2R)-N-(4-butoxy-2-cyanophenyl)-2-methoxy-2-methylbutanamide |
| SMILES | CCCCOc1ccc(NC(=O)[C@@](C)(CC)OC)c(C#N)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-5-7-10-22-14-8-9-15(13(11-14)12-18)19-16(20)17(3,6-2)21-4/h8-9,11H,5-7,10H2,1-4H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | IYQZDYYYQPMMJP-QGZVFWFLSA-N |
| XLogP | 3.49 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|