C17H24N2O3 — CID 100765089
(2S)-N-(2-cyano-4-methoxyphenyl)-2-methyl-2-propoxypentanamide (PubChem CID 100765089) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S)-N-(2-cyano-4-methoxyphenyl)-2-methyl-2-propoxypentanamide.
| Compound Name | (2S)-N-(2-cyano-4-methoxyphenyl)-2-methyl-2-propoxypentanamide |
|---|---|
| PubChem CID | 100765089 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2S)-N-(2-cyano-4-methoxyphenyl)-2-methyl-2-propoxypentanamide |
| SMILES | CCCO[C@@](C)(CCC)C(=O)Nc1ccc(OC)cc1C#N |
| InChI | InChI=1S/C17H24N2O3/c1-5-9-17(3,22-10-6-2)16(20)19-15-8-7-14(21-4)11-13(15)12-18/h7-8,11H,5-6,9-10H2,1-4H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | YACBEKLWCUXCMK-KRWDZBQOSA-N |
| XLogP | 3.49 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |