C19H26N2O4 — CID 100764800
[3-cyano-4-[[(2S)-2,4-dimethyl-2-propoxypentanoyl]amino]phenyl] acetate (PubChem CID 100764800) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [3-cyano-4-[[(2S)-2,4-dimethyl-2-propoxypentanoyl]amino]phenyl] acetate.
| Compound Name | [3-cyano-4-[[(2S)-2,4-dimethyl-2-propoxypentanoyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 100764800 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [3-cyano-4-[[(2S)-2,4-dimethyl-2-propoxypentanoyl]amino]phenyl] acetate |
| SMILES | CCCO[C@@](C)(CC(C)C)C(=O)Nc1ccc(OC(C)=O)cc1C#N |
| InChI | InChI=1S/C19H26N2O4/c1-6-9-24-19(5,11-13(2)3)18(23)21-17-8-7-16(25-14(4)22)10-15(17)12-20/h7-8,10,13H,6,9,11H2,1-5H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | KTTVHTHUAOLPBA-IBGZPJMESA-N |
| XLogP | 3.65 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|