C18H24N2O4 — CID 100765356
[3-cyano-4-[[(2S)-2-methyl-2-propoxypentanoyl]amino]phenyl] acetate (PubChem CID 100765356) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is [3-cyano-4-[[(2S)-2-methyl-2-propoxypentanoyl]amino]phenyl] acetate.
| Compound Name | [3-cyano-4-[[(2S)-2-methyl-2-propoxypentanoyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 100765356 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [3-cyano-4-[[(2S)-2-methyl-2-propoxypentanoyl]amino]phenyl] acetate |
| SMILES | CCCO[C@@](C)(CCC)C(=O)Nc1ccc(OC(C)=O)cc1C#N |
| InChI | InChI=1S/C18H24N2O4/c1-5-9-18(4,23-10-6-2)17(22)20-16-8-7-15(24-13(3)21)11-14(16)12-19/h7-8,11H,5-6,9-10H2,1-4H3,(H,20,22)/t18-/m0/s1 |
| InChIKey | ZQAPGNVSPYGVMW-SFHVURJKSA-N |
| XLogP | 3.41 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|