C17H20N2O4 — CID 100763613
[3-cyano-4-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]phenyl] acetate (PubChem CID 100763613) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is [3-cyano-4-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]phenyl] acetate.
| Compound Name | [3-cyano-4-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 100763613 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [3-cyano-4-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]phenyl] acetate |
| SMILES | CCO[C@@](C)(C(=O)Nc1ccc(OC(C)=O)cc1C#N)C1CC1 |
| InChI | InChI=1S/C17H20N2O4/c1-4-22-17(3,13-5-6-13)16(21)19-15-8-7-14(23-11(2)20)9-12(15)10-18/h7-9,13H,4-6H2,1-3H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | MOSHTUHVBJPMAB-QGZVFWFLSA-N |
| XLogP | 2.63 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|