C23H33NO3 — CID 100761072
(2R)-2-ethoxy-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]hexanamide (PubChem CID 100761072) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is (2R)-2-ethoxy-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]hexanamide.
| Compound Name | (2R)-2-ethoxy-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]hexanamide |
|---|---|
| PubChem CID | 100761072 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (2R)-2-ethoxy-2-methyl-N-[4-(2-methylpropoxy)naphthalen-1-yl]hexanamide |
| SMILES | CCCC[C@@](C)(OCC)C(=O)Nc1ccc(OCC(C)C)c2ccccc12 |
| InChI | InChI=1S/C23H33NO3/c1-6-8-15-23(5,27-7-2)22(25)24-20-13-14-21(26-16-17(3)4)19-12-10-9-11-18(19)20/h9-14,17H,6-8,15-16H2,1-5H3,(H,24,25)/t23-/m1/s1 |
| InChIKey | PBUKETDZANQDGG-HSZRJFAPSA-N |
| XLogP | 5.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |