C21H30N2O3 — CID 100776505
(2R)-N-(8-butoxyquinolin-5-yl)-2-ethoxy-2-methylpentanamide (PubChem CID 100776505) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2R)-N-(8-butoxyquinolin-5-yl)-2-ethoxy-2-methylpentanamide.
| Compound Name | (2R)-N-(8-butoxyquinolin-5-yl)-2-ethoxy-2-methylpentanamide |
|---|---|
| PubChem CID | 100776505 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (2R)-N-(8-butoxyquinolin-5-yl)-2-ethoxy-2-methylpentanamide |
| SMILES | CCCCOc1ccc(NC(=O)[C@@](C)(CCC)OCC)c2cccnc12 |
| InChI | InChI=1S/C21H30N2O3/c1-5-8-15-25-18-12-11-17(16-10-9-14-22-19(16)18)23-20(24)21(4,13-6-2)26-7-3/h9-12,14H,5-8,13,15H2,1-4H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | FQMOACYSXPNTND-OAQYLSRUSA-N |
| XLogP | 4.95 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|