C18H24N2O2 — CID 100773589
N-(8-butoxyquinolin-5-yl)-2,2-dimethylpropanamide (PubChem CID 100773589) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(8-butoxyquinolin-5-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(8-butoxyquinolin-5-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100773589 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(8-butoxyquinolin-5-yl)-2,2-dimethylpropanamide |
| SMILES | CCCCOc1ccc(NC(=O)C(C)(C)C)c2cccnc12 |
| InChI | InChI=1S/C18H24N2O2/c1-5-6-12-22-15-10-9-14(20-17(21)18(2,3)4)13-8-7-11-19-16(13)15/h7-11H,5-6,12H2,1-4H3,(H,20,21) |
| InChIKey | JACALSJAGPCZSK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|