C20H28N2O3 — CID 100776850
(2R)-2-ethoxy-N-(8-methoxyquinolin-5-yl)-2-methylheptanamide (PubChem CID 100776850) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-(8-methoxyquinolin-5-yl)-2-methylheptanamide.
| Compound Name | (2R)-2-ethoxy-N-(8-methoxyquinolin-5-yl)-2-methylheptanamide |
|---|---|
| PubChem CID | 100776850 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (2R)-2-ethoxy-N-(8-methoxyquinolin-5-yl)-2-methylheptanamide |
| SMILES | CCCCC[C@@](C)(OCC)C(=O)Nc1ccc(OC)c2ncccc12 |
| InChI | InChI=1S/C20H28N2O3/c1-5-7-8-13-20(3,25-6-2)19(23)22-16-11-12-17(24-4)18-15(16)10-9-14-21-18/h9-12,14H,5-8,13H2,1-4H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | RKBNCYAEASTATR-HXUWFJFHSA-N |
| XLogP | 4.56 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|