C22H32N2O3 — CID 100777802
(2R)-2,4-dimethyl-2-propoxy-N-(8-propoxyquinolin-5-yl)pentanamide (PubChem CID 100777802) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is (2R)-2,4-dimethyl-2-propoxy-N-(8-propoxyquinolin-5-yl)pentanamide.
| Compound Name | (2R)-2,4-dimethyl-2-propoxy-N-(8-propoxyquinolin-5-yl)pentanamide |
|---|---|
| PubChem CID | 100777802 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (2R)-2,4-dimethyl-2-propoxy-N-(8-propoxyquinolin-5-yl)pentanamide |
| SMILES | CCCOc1ccc(NC(=O)[C@@](C)(CC(C)C)OCCC)c2cccnc12 |
| InChI | InChI=1S/C22H32N2O3/c1-6-13-26-19-11-10-18(17-9-8-12-23-20(17)19)24-21(25)22(5,15-16(3)4)27-14-7-2/h8-12,16H,6-7,13-15H2,1-5H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | YXCPXIMENOWERF-JOCHJYFZSA-N |
| XLogP | 5.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |