C22H37NO3 — CID 133246325
2-methyl-N-[3-methyl-4-(2-methylpropoxy)phenyl]-2-propoxyheptanamide (PubChem CID 133246325) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 2-methyl-N-[3-methyl-4-(2-methylpropoxy)phenyl]-2-propoxyheptanamide.
| Compound Name | 2-methyl-N-[3-methyl-4-(2-methylpropoxy)phenyl]-2-propoxyheptanamide |
|---|---|
| PubChem CID | 133246325 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 2-methyl-N-[3-methyl-4-(2-methylpropoxy)phenyl]-2-propoxyheptanamide |
| SMILES | CCCCCC(C)(OCCC)C(=O)Nc1ccc(OCC(C)C)c(C)c1 |
| InChI | InChI=1S/C22H37NO3/c1-7-9-10-13-22(6,26-14-8-2)21(24)23-19-11-12-20(18(5)15-19)25-16-17(3)4/h11-12,15,17H,7-10,13-14,16H2,1-6H3,(H,23,24) |
| InChIKey | IUSBCUDISOGXAG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|