C20H30F3NO3 — CID 100766204
(2R)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxyheptanamide (PubChem CID 100766204) has the molecular formula C20H30F3NO3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (2R)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxyheptanamide.
| Compound Name | (2R)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxyheptanamide |
|---|---|
| PubChem CID | 100766204 |
| Molecular Formula | C20H30F3NO3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (2R)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxyheptanamide |
| SMILES | CCCCC[C@@](C)(OCCC)C(=O)Nc1ccc(OCC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H30F3NO3/c1-5-8-9-12-19(4,27-13-6-2)18(25)24-15-10-11-17(26-7-3)16(14-15)20(21,22)23/h10-11,14H,5-9,12-13H2,1-4H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | MZTQOYUAROBTSJ-LJQANCHMSA-N |
| XLogP | 5.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|