C17H24F3NO3 — CID 100763997
(2S)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxybutanamide (PubChem CID 100763997) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is (2S)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxybutanamide.
| Compound Name | (2S)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxybutanamide |
|---|---|
| PubChem CID | 100763997 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S)-N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2-methyl-2-propoxybutanamide |
| SMILES | CCCO[C@@](C)(CC)C(=O)Nc1ccc(OCC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3NO3/c1-5-10-24-16(4,6-2)15(22)21-12-8-9-14(23-7-3)13(11-12)17(18,19)20/h8-9,11H,5-7,10H2,1-4H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | LKIXNCFPQOSTEH-INIZCTEOSA-N |
| XLogP | 4.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |