C16H22F3NO3 — CID 100759967
(2S)-2-ethoxy-N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-methylpentanamide (PubChem CID 100759967) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (2S)-2-ethoxy-N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-methylpentanamide.
| Compound Name | (2S)-2-ethoxy-N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 100759967 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2S)-2-ethoxy-N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-methylpentanamide |
| SMILES | CCC[C@](C)(OCC)C(=O)Nc1ccc(OC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H22F3NO3/c1-5-9-15(3,23-6-2)14(21)20-11-7-8-13(22-4)12(10-11)16(17,18)19/h7-8,10H,5-6,9H2,1-4H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | RRYKZFPVPAOXQH-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |