C14H18F3NO2 — CID 100750932
N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 100750932) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100750932 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[4-ethoxy-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CCOc1ccc(NC(=O)C(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO2/c1-5-20-11-7-6-9(8-10(11)14(15,16)17)18-12(19)13(2,3)4/h6-8H,5H2,1-4H3,(H,18,19) |
| InChIKey | ZQKZPACKASKAQB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |