C12H12F3NO4 — CID 100750375
methyl 2-ethoxy-5-[(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 100750375) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is methyl 2-ethoxy-5-[(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | methyl 2-ethoxy-5-[(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 100750375 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl 2-ethoxy-5-[(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | CCOc1ccc(NC(=O)C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C12H12F3NO4/c1-3-20-9-5-4-7(6-8(9)10(17)19-2)16-11(18)12(13,14)15/h4-6H,3H2,1-2H3,(H,16,18) |
| InChIKey | PSRBTSHDBDVCEQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |