C10H7ClF3NO3 — CID 118454929
methyl 2-chloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 118454929) has the molecular formula C10H7ClF3NO3 and a molecular weight of 281.62 g/mol. Its IUPAC name is methyl 2-chloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | methyl 2-chloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 118454929 |
| Molecular Formula | C10H7ClF3NO3 |
| Molecular Weight | 281.62 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | methyl 2-chloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H7ClF3NO3/c1-18-8(16)6-3-2-5(4-7(6)11)15-9(17)10(12,13)14/h2-4H,1H3,(H,15,17) |
| InChIKey | FOBCTCDLNQVKHB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |