C14H18Cl2N2O3 — CID 119329511
methyl 4-[(1-aminocyclopentanecarbonyl)amino]-2-chlorobenzoate;hydrochloride (PubChem CID 119329511) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is methyl 4-[(1-aminocyclopentanecarbonyl)amino]-2-chlorobenzoate;hydrochloride.
| Compound Name | methyl 4-[(1-aminocyclopentanecarbonyl)amino]-2-chlorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 119329511 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | methyl 4-[(1-aminocyclopentanecarbonyl)amino]-2-chlorobenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(NC(=O)C2(N)CCCC2)cc1Cl.Cl |
| InChI | InChI=1S/C14H17ClN2O3.ClH/c1-20-12(18)10-5-4-9(8-11(10)15)17-13(19)14(16)6-2-3-7-14;/h4-5,8H,2-3,6-7,16H2,1H3,(H,17,19);1H |
| InChIKey | FXWULJJHEMVOCK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |