C16H20ClN3O2 — CID 119776900
1-amino-N-[3-chloro-4-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 119776900) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-amino-N-[3-chloro-4-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-[3-chloro-4-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119776900 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-amino-N-[3-chloro-4-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | NC1(C(=O)Nc2ccc(C(=O)N3CCCCC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c17-13-10-11(19-15(22)16(18)6-7-16)4-5-12(13)14(21)20-8-2-1-3-9-20/h4-5,10H,1-3,6-9,18H2,(H,19,22) |
| InChIKey | UYERMNOHNLOVOG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |