C18H25NO5 — CID 100761596
methyl 2-ethoxy-5-[(1-ethoxycyclopentanecarbonyl)amino]benzoate (PubChem CID 100761596) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl 2-ethoxy-5-[(1-ethoxycyclopentanecarbonyl)amino]benzoate.
| Compound Name | methyl 2-ethoxy-5-[(1-ethoxycyclopentanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 100761596 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl 2-ethoxy-5-[(1-ethoxycyclopentanecarbonyl)amino]benzoate |
| SMILES | CCOc1ccc(NC(=O)C2(OCC)CCCC2)cc1C(=O)OC |
| InChI | InChI=1S/C18H25NO5/c1-4-23-15-9-8-13(12-14(15)16(20)22-3)19-17(21)18(24-5-2)10-6-7-11-18/h8-9,12H,4-7,10-11H2,1-3H3,(H,19,21) |
| InChIKey | JMUHXRBEFIIMHV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |