C20H29NO5 — CID 100761921
ethyl 2-ethoxy-5-[(1-ethoxycyclohexanecarbonyl)amino]benzoate (PubChem CID 100761921) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is ethyl 2-ethoxy-5-[(1-ethoxycyclohexanecarbonyl)amino]benzoate.
| Compound Name | ethyl 2-ethoxy-5-[(1-ethoxycyclohexanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 100761921 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | ethyl 2-ethoxy-5-[(1-ethoxycyclohexanecarbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)C2(OCC)CCCCC2)ccc1OCC |
| InChI | InChI=1S/C20H29NO5/c1-4-24-17-11-10-15(14-16(17)18(22)25-5-2)21-19(23)20(26-6-3)12-8-7-9-13-20/h10-11,14H,4-9,12-13H2,1-3H3,(H,21,23) |
| InChIKey | VZAPGBIXDPRMBM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |