C23H35NO5 — CID 133203950
ethyl 2-butoxy-5-[(1-ethoxy-3-methylcyclohexanecarbonyl)amino]benzoate (PubChem CID 133203950) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethyl 2-butoxy-5-[(1-ethoxy-3-methylcyclohexanecarbonyl)amino]benzoate.
| Compound Name | ethyl 2-butoxy-5-[(1-ethoxy-3-methylcyclohexanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 133203950 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | ethyl 2-butoxy-5-[(1-ethoxy-3-methylcyclohexanecarbonyl)amino]benzoate |
| SMILES | CCCCOc1ccc(NC(=O)C2(OCC)CCCC(C)C2)cc1C(=O)OCC |
| InChI | InChI=1S/C23H35NO5/c1-5-8-14-28-20-12-11-18(15-19(20)21(25)27-6-2)24-22(26)23(29-7-3)13-9-10-17(4)16-23/h11-12,15,17H,5-10,13-14,16H2,1-4H3,(H,24,26) |
| InChIKey | OGECNACAGFGAIG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|