C22H33NO5 — CID 100757676
ethyl 2-butoxy-5-[(1-methoxy-4-methylcyclohexanecarbonyl)amino]benzoate (PubChem CID 100757676) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl 2-butoxy-5-[(1-methoxy-4-methylcyclohexanecarbonyl)amino]benzoate.
| Compound Name | ethyl 2-butoxy-5-[(1-methoxy-4-methylcyclohexanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 100757676 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | ethyl 2-butoxy-5-[(1-methoxy-4-methylcyclohexanecarbonyl)amino]benzoate |
| SMILES | CCCCOc1ccc(NC(=O)C2(OC)CCC(C)CC2)cc1C(=O)OCC |
| InChI | InChI=1S/C22H33NO5/c1-5-7-14-28-19-9-8-17(15-18(19)20(24)27-6-2)23-21(25)22(26-4)12-10-16(3)11-13-22/h8-9,15-16H,5-7,10-14H2,1-4H3,(H,23,25) |
| InChIKey | NTZVBGMVGCOJBA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|