C25H24F3NO3 — CID 100784401
N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-2,2-diphenylpropanamide (PubChem CID 100784401) has the molecular formula C25H24F3NO3 and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-2,2-diphenylpropanamide.
| Compound Name | N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-2,2-diphenylpropanamide |
|---|---|
| PubChem CID | 100784401 |
| Molecular Formula | C25H24F3NO3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-2,2-diphenylpropanamide |
| SMILES | COCCOc1ccc(NC(=O)C(C)(c2ccccc2)c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H24F3NO3/c1-24(18-9-5-3-6-10-18,19-11-7-4-8-12-19)23(30)29-20-13-14-22(32-16-15-31-2)21(17-20)25(26,27)28/h3-14,17H,15-16H2,1-2H3,(H,29,30) |
| InChIKey | SMMBJLOEYWOFCH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|