C26H24F3NO2 — CID 100784419
2,2-diphenyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]butanamide (PubChem CID 100784419) has the molecular formula C26H24F3NO2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2,2-diphenyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2,2-diphenyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 100784419 |
| Molecular Formula | C26H24F3NO2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2,2-diphenyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]butanamide |
| SMILES | C=CCOc1ccc(NC(=O)C(CC)(c2ccccc2)c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H24F3NO2/c1-3-17-32-23-16-15-21(18-22(23)26(27,28)29)30-24(31)25(4-2,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h3,5-16,18H,1,4,17H2,2H3,(H,30,31) |
| InChIKey | YOMAVYHNBSNNQE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|