C23H22F3N2O6P — CID 58725033
[(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-phenylphenoxy)-3-(trifluoromethyl)anilino]propyl] dihydrogen phosphate (PubChem CID 58725033) has the molecular formula C23H22F3N2O6P and a molecular weight of 510.41 g/mol. Its IUPAC name is [(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-phenylphenoxy)-3-(trifluoromethyl)anilino]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-phenylphenoxy)-3-(trifluoromethyl)anilino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58725033 |
| Molecular Formula | C23H22F3N2O6P |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-phenylphenoxy)-3-(trifluoromethyl)anilino]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)C(=O)Nc1ccc(Oc2ccc(-c3ccccc3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F3N2O6P/c1-22(27,14-33-35(30,31)32)21(29)28-17-9-12-20(19(13-17)23(24,25)26)34-18-10-7-16(8-11-18)15-5-3-2-4-6-15/h2-13H,14,27H2,1H3,(H,28,29)(H2,30,31,32)/t22-/m0/s1 |
| InChIKey | LZTPWFPNVFSRQA-QFIPXVFZSA-N |
| XLogP | 4.93 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|