C24H27N2O6PS — CID 69276552
[2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfinyl]anilino]propyl] dihydrogen phosphate (PubChem CID 69276552) has the molecular formula C24H27N2O6PS and a molecular weight of 502.53 g/mol. Its IUPAC name is [2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfinyl]anilino]propyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfinyl]anilino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69276552 |
| Molecular Formula | C24H27N2O6PS |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfinyl]anilino]propyl] dihydrogen phosphate |
| SMILES | CC(N)(COP(=O)(O)O)C(=O)Nc1ccc(S(=O)CCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H27N2O6PS/c1-24(25,17-32-33(28,29)30)23(27)26-21-11-13-22(14-12-21)34(31)16-15-18-7-9-20(10-8-18)19-5-3-2-4-6-19/h2-14H,15-17,25H2,1H3,(H,26,27)(H2,28,29,30) |
| InChIKey | GGWRDNKSZPDYIT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|