C26H31N2O6P — CID 69114096
[(2S)-2-amino-3-[4-(1,4-diphenylbutan-2-yloxy)anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate (PubChem CID 69114096) has the molecular formula C26H31N2O6P and a molecular weight of 498.52 g/mol. Its IUPAC name is [(2S)-2-amino-3-[4-(1,4-diphenylbutan-2-yloxy)anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-3-[4-(1,4-diphenylbutan-2-yloxy)anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69114096 |
| Molecular Formula | C26H31N2O6P |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [(2S)-2-amino-3-[4-(1,4-diphenylbutan-2-yloxy)anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)C(=O)Nc1ccc(OC(CCc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H31N2O6P/c1-26(27,19-33-35(30,31)32)25(29)28-22-13-16-23(17-14-22)34-24(18-21-10-6-3-7-11-21)15-12-20-8-4-2-5-9-20/h2-11,13-14,16-17,24H,12,15,18-19,27H2,1H3,(H,28,29)(H2,30,31,32)/t24?,26-/m0/s1 |
| InChIKey | UNGZKGCGSZWYCL-JKGBFCRXSA-N |
| XLogP | 4.07 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|