C17H18F3N2O6P — CID 11683489
[(2S)-2-amino-2-methyl-3-oxo-3-[4-[3-(trifluoromethyl)phenoxy]anilino]propyl] dihydrogen phosphate (PubChem CID 11683489) has the molecular formula C17H18F3N2O6P and a molecular weight of 434.31 g/mol. Its IUPAC name is [(2S)-2-amino-2-methyl-3-oxo-3-[4-[3-(trifluoromethyl)phenoxy]anilino]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[3-(trifluoromethyl)phenoxy]anilino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11683489 |
| Molecular Formula | C17H18F3N2O6P |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[3-(trifluoromethyl)phenoxy]anilino]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)C(=O)Nc1ccc(Oc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H18F3N2O6P/c1-16(21,10-27-29(24,25)26)15(23)22-12-5-7-13(8-6-12)28-14-4-2-3-11(9-14)17(18,19)20/h2-9H,10,21H2,1H3,(H,22,23)(H2,24,25,26)/t16-/m0/s1 |
| InChIKey | ONAGQOBLSGNFER-INIZCTEOSA-N |
| XLogP | 3.26 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|