C18H20ClF3N2O3 — CID 120592787
4-amino-3-methoxy-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]butanamide;hydrochloride (PubChem CID 120592787) has the molecular formula C18H20ClF3N2O3 and a molecular weight of 404.82 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120592787 |
| Molecular Formula | C18H20ClF3N2O3 |
| Molecular Weight | 404.82 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-amino-3-methoxy-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)Nc1ccc(Oc2cccc(C(F)(F)F)c2)cc1.Cl |
| InChI | InChI=1S/C18H19F3N2O3.ClH/c1-25-16(11-22)10-17(24)23-13-5-7-14(8-6-13)26-15-4-2-3-12(9-15)18(19,20)21;/h2-9,16H,10-11,22H2,1H3,(H,23,24);1H |
| InChIKey | ZYSMXHJRGSZYDA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |