C17H25F3N2O2 — CID 120591392
4-amino-3-methoxy-N-[3-methyl-1-[3-(trifluoromethyl)phenyl]butyl]butanamide (PubChem CID 120591392) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[3-methyl-1-[3-(trifluoromethyl)phenyl]butyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[3-methyl-1-[3-(trifluoromethyl)phenyl]butyl]butanamide |
|---|---|
| PubChem CID | 120591392 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-amino-3-methoxy-N-[3-methyl-1-[3-(trifluoromethyl)phenyl]butyl]butanamide |
| SMILES | COC(CN)CC(=O)NC(CC(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H25F3N2O2/c1-11(2)7-15(22-16(23)9-14(10-21)24-3)12-5-4-6-13(8-12)17(18,19)20/h4-6,8,11,14-15H,7,9-10,21H2,1-3H3,(H,22,23) |
| InChIKey | NRIRUTTUSXXRMP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |