C16H23F3N2O2 — CID 120592804
4-amino-N-ethyl-3-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide (PubChem CID 120592804) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide.
| Compound Name | 4-amino-N-ethyl-3-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 120592804 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-amino-N-ethyl-3-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide |
| SMILES | CCN(C(=O)CC(CN)OC)C(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H23F3N2O2/c1-4-21(15(22)9-14(10-20)23-3)11(2)12-6-5-7-13(8-12)16(17,18)19/h5-8,11,14H,4,9-10,20H2,1-3H3 |
| InChIKey | BPHGTSXQJXBXTL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |