C20H23F3N2O — CID 120611042
3-(2-aminophenyl)-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide (PubChem CID 120611042) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 120611042 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-(2-aminophenyl)-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide |
| SMILES | CCN(C(=O)CCc1ccccc1N)C(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N2O/c1-3-25(19(26)12-11-15-7-4-5-10-18(15)24)14(2)16-8-6-9-17(13-16)20(21,22)23/h4-10,13-14H,3,11-12,24H2,1-2H3 |
| InChIKey | BTZBGPQFFZVLTO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|