C18H21ClN2O — CID 120608860
3-(2-aminophenyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylpropanamide (PubChem CID 120608860) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylpropanamide.
| Compound Name | 3-(2-aminophenyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 120608860 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylpropanamide |
| SMILES | CC(c1cccc(Cl)c1)N(C)C(=O)CCc1ccccc1N |
| InChI | InChI=1S/C18H21ClN2O/c1-13(15-7-5-8-16(19)12-15)21(2)18(22)11-10-14-6-3-4-9-17(14)20/h3-9,12-13H,10-11,20H2,1-2H3 |
| InChIKey | ZRFWCWYLSYBTDA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|