C18H19ClFNOS — CID 55595194
N-[1-(3-chlorophenyl)ethyl]-3-(4-fluorophenyl)sulfanyl-N-methylpropanamide (PubChem CID 55595194) has the molecular formula C18H19ClFNOS and a molecular weight of 351.87 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-3-(4-fluorophenyl)sulfanyl-N-methylpropanamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-3-(4-fluorophenyl)sulfanyl-N-methylpropanamide |
|---|---|
| PubChem CID | 55595194 |
| Molecular Formula | C18H19ClFNOS |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-3-(4-fluorophenyl)sulfanyl-N-methylpropanamide |
| SMILES | CC(c1cccc(Cl)c1)N(C)C(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19ClFNOS/c1-13(14-4-3-5-15(19)12-14)21(2)18(22)10-11-23-17-8-6-16(20)7-9-17/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | SCPUQNCBNBPTLZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |