C18H25F3N2O — CID 119794789
3-amino-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexane-1-carboxamide (PubChem CID 119794789) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is 3-amino-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119794789 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-amino-N-ethyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexane-1-carboxamide |
| SMILES | CCN(C(=O)C1CCCC(N)C1)C(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H25F3N2O/c1-3-23(17(24)14-7-5-9-16(22)11-14)12(2)13-6-4-8-15(10-13)18(19,20)21/h4,6,8,10,12,14,16H,3,5,7,9,11,22H2,1-2H3 |
| InChIKey | BXRISXMXOZUFSK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |