C14H18F3NO2 — CID 95571773
N-ethyl-2-methoxy-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 95571773) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-ethyl-2-methoxy-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | N-ethyl-2-methoxy-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 95571773 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-ethyl-2-methoxy-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | CCN(C(=O)COC)[C@H](C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO2/c1-4-18(13(19)9-20-3)10(2)11-6-5-7-12(8-11)14(15,16)17/h5-8,10H,4,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | WOWZEIROZBHECQ-SNVBAGLBSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |