C21H29ClN2O — CID 120611121
3-(2-aminophenyl)-N-butyl-N-(1-phenylethyl)propanamide;hydrochloride (PubChem CID 120611121) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-butyl-N-(1-phenylethyl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-butyl-N-(1-phenylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120611121 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-(2-aminophenyl)-N-butyl-N-(1-phenylethyl)propanamide;hydrochloride |
| SMILES | CCCCN(C(=O)CCc1ccccc1N)C(C)c1ccccc1.Cl |
| InChI | InChI=1S/C21H28N2O.ClH/c1-3-4-16-23(17(2)18-10-6-5-7-11-18)21(24)15-14-19-12-8-9-13-20(19)22;/h5-13,17H,3-4,14-16,22H2,1-2H3;1H |
| InChIKey | PRDUCVDVXXESIG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|