C12H17ClF2N2O3 — CID 120586597
4-amino-N-[4-(difluoromethoxy)phenyl]-3-methoxybutanamide;hydrochloride (PubChem CID 120586597) has the molecular formula C12H17ClF2N2O3 and a molecular weight of 310.73 g/mol. Its IUPAC name is 4-amino-N-[4-(difluoromethoxy)phenyl]-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-(difluoromethoxy)phenyl]-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120586597 |
| Molecular Formula | C12H17ClF2N2O3 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-amino-N-[4-(difluoromethoxy)phenyl]-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)Nc1ccc(OC(F)F)cc1.Cl |
| InChI | InChI=1S/C12H16F2N2O3.ClH/c1-18-10(7-15)6-11(17)16-8-2-4-9(5-3-8)19-12(13)14;/h2-5,10,12H,6-7,15H2,1H3,(H,16,17);1H |
| InChIKey | JHEKBMIQGLFLCI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |